C22H21ClF3N3O4 — CID 4996190
N-[5-chloro-2-[3-oxo-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]morpholin-4-yl]prop-1-enyl]phenyl]acetamide (PubChem CID 4996190) has the molecular formula C22H21ClF3N3O4 and a molecular weight of 483.87 g/mol. Its IUPAC name is N-[5-chloro-2-[3-oxo-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]morpholin-4-yl]prop-1-enyl]phenyl]acetamide.
| Compound Name | N-[5-chloro-2-[3-oxo-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]morpholin-4-yl]prop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 4996190 |
| Molecular Formula | C22H21ClF3N3O4 |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | N-[5-chloro-2-[3-oxo-3-[2-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]morpholin-4-yl]prop-1-enyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(Cl)ccc1C=CC(=O)N1CCOC(COc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C22H21ClF3N3O4/c1-14(30)28-19-10-17(23)5-2-15(19)3-7-21(31)29-8-9-32-18(12-29)13-33-20-6-4-16(11-27-20)22(24,25)26/h2-7,10-11,18H,8-9,12-13H2,1H3,(H,28,30) |
| InChIKey | ONKSRNDLQNQTMV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|