C18H21ClN2O5 — CID 3742288
[5-[[2-[(5-chloro-2-pyridinyl)oxymethyl]morpholin-4-yl]methyl]furan-2-yl]methyl acetate (PubChem CID 3742288) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is [5-[[2-[(5-chloro-2-pyridinyl)oxymethyl]morpholin-4-yl]methyl]furan-2-yl]methyl acetate.
| Compound Name | [5-[[2-[(5-chloro-2-pyridinyl)oxymethyl]morpholin-4-yl]methyl]furan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 3742288 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [5-[[2-[(5-chloro-2-pyridinyl)oxymethyl]morpholin-4-yl]methyl]furan-2-yl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(CN2CCOC(COc3ccc(Cl)cn3)C2)o1 |
| InChI | InChI=1S/C18H21ClN2O5/c1-13(22)24-11-16-4-3-15(26-16)9-21-6-7-23-17(10-21)12-25-18-5-2-14(19)8-20-18/h2-5,8,17H,6-7,9-12H2,1H3 |
| InChIKey | YRXPAZLWIJBNSR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |