C13H19N3O3 — CID 89443070
[4-[(3-amino-4-pyridinyl)methyl]morpholin-2-yl]methyl acetate (PubChem CID 89443070) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is [4-[(3-amino-4-pyridinyl)methyl]morpholin-2-yl]methyl acetate.
| Compound Name | [4-[(3-amino-4-pyridinyl)methyl]morpholin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 89443070 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | [4-[(3-amino-4-pyridinyl)methyl]morpholin-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CN(Cc2ccncc2N)CCO1 |
| InChI | InChI=1S/C13H19N3O3/c1-10(17)19-9-12-8-16(4-5-18-12)7-11-2-3-15-6-13(11)14/h2-3,6,12H,4-5,7-9,14H2,1H3 |
| InChIKey | GYJWUNFHUDBDFB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |