C13H19ClN2O — CID 79582785
4-chloro-2-[(2-ethylmorpholin-4-yl)methyl]aniline (PubChem CID 79582785) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 4-chloro-2-[(2-ethylmorpholin-4-yl)methyl]aniline.
| Compound Name | 4-chloro-2-[(2-ethylmorpholin-4-yl)methyl]aniline |
|---|---|
| PubChem CID | 79582785 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-chloro-2-[(2-ethylmorpholin-4-yl)methyl]aniline |
| SMILES | CCC1CN(Cc2cc(Cl)ccc2N)CCO1 |
| InChI | InChI=1S/C13H19ClN2O/c1-2-12-9-16(5-6-17-12)8-10-7-11(14)3-4-13(10)15/h3-4,7,12H,2,5-6,8-9,15H2,1H3 |
| InChIKey | OHGPUOQFECDWGQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|