C12H17Cl2FN2O — CID 120844387
[4-[(4-chloro-2-fluorophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride (PubChem CID 120844387) has the molecular formula C12H17Cl2FN2O and a molecular weight of 295.18 g/mol. Its IUPAC name is [4-[(4-chloro-2-fluorophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride.
| Compound Name | [4-[(4-chloro-2-fluorophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120844387 |
| Molecular Formula | C12H17Cl2FN2O |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | [4-[(4-chloro-2-fluorophenyl)methyl]morpholin-2-yl]methanamine;hydrochloride |
| SMILES | Cl.NCC1CN(Cc2ccc(Cl)cc2F)CCO1 |
| InChI | InChI=1S/C12H16ClFN2O.ClH/c13-10-2-1-9(12(14)5-10)7-16-3-4-17-11(6-15)8-16;/h1-2,5,11H,3-4,6-8,15H2;1H |
| InChIKey | NVAQVHPDORTHMX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |