C15H23Cl3N2O2 — CID 154887461
[4-[(5-chloro-2-prop-2-enoxyphenyl)methyl]morpholin-2-yl]methanamine;dihydrochloride (PubChem CID 154887461) has the molecular formula C15H23Cl3N2O2 and a molecular weight of 369.72 g/mol. Its IUPAC name is [4-[(5-chloro-2-prop-2-enoxyphenyl)methyl]morpholin-2-yl]methanamine;dihydrochloride.
| Compound Name | [4-[(5-chloro-2-prop-2-enoxyphenyl)methyl]morpholin-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 154887461 |
| Molecular Formula | C15H23Cl3N2O2 |
| Molecular Weight | 369.72 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | [4-[(5-chloro-2-prop-2-enoxyphenyl)methyl]morpholin-2-yl]methanamine;dihydrochloride |
| SMILES | C=CCOc1ccc(Cl)cc1CN1CCOC(CN)C1.Cl.Cl |
| InChI | InChI=1S/C15H21ClN2O2.2ClH/c1-2-6-20-15-4-3-13(16)8-12(15)10-18-5-7-19-14(9-17)11-18;;/h2-4,8,14H,1,5-7,9-11,17H2;2*1H |
| InChIKey | WWQDWQXATUMDCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|