C17H26Cl2N2O2 — CID 11958772
N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;hydrochloride (PubChem CID 11958772) has the molecular formula C17H26Cl2N2O2 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;hydrochloride.
| Compound Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 11958772 |
| Molecular Formula | C17H26Cl2N2O2 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(5-chloro-2-prop-2-enoxyphenyl)methyl]-3-morpholin-4-ylpropan-1-amine;hydrochloride |
| SMILES | C=CCOc1ccc(Cl)cc1CNCCCN1CCOCC1.Cl |
| InChI | InChI=1S/C17H25ClN2O2.ClH/c1-2-10-22-17-5-4-16(18)13-15(17)14-19-6-3-7-20-8-11-21-12-9-20;/h2,4-5,13,19H,1,3,6-12,14H2;1H |
| InChIKey | GVRGLCZHVHPILI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|