C14H20Cl2N2O — CID 65316209
N-[(2,5-dichlorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 65316209) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is N-[(2,5-dichlorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[(2,5-dichlorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 65316209 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | N-[(2,5-dichlorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | Clc1ccc(Cl)c(CNCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c15-13-2-3-14(16)12(10-13)11-17-4-1-5-18-6-8-19-9-7-18/h2-3,10,17H,1,4-9,11H2 |
| InChIKey | NDJWUMOCQAXGER-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|