C14H20F2N2O — CID 28672164
N-[(3,4-difluorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine (PubChem CID 28672164) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 28672164 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-3-morpholin-4-ylpropan-1-amine |
| SMILES | Fc1ccc(CNCCCN2CCOCC2)cc1F |
| InChI | InChI=1S/C14H20F2N2O/c15-13-3-2-12(10-14(13)16)11-17-4-1-5-18-6-8-19-9-7-18/h2-3,10,17H,1,4-9,11H2 |
| InChIKey | WAXNTEAABKCIHE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|