C12H22Cl2N2OS — CID 17332415
3-morpholin-4-yl-N-(thiophen-3-ylmethyl)propan-1-amine;dihydrochloride (PubChem CID 17332415) has the molecular formula C12H22Cl2N2OS and a molecular weight of 313.29 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-(thiophen-3-ylmethyl)propan-1-amine;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-N-(thiophen-3-ylmethyl)propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17332415 |
| Molecular Formula | C12H22Cl2N2OS |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-morpholin-4-yl-N-(thiophen-3-ylmethyl)propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.c1cc(CNCCCN2CCOCC2)cs1 |
| InChI | InChI=1S/C12H20N2OS.2ClH/c1(4-14-5-7-15-8-6-14)3-13-10-12-2-9-16-11-12;;/h2,9,11,13H,1,3-8,10H2;2*1H |
| InChIKey | MCZIIEYFOJGCQM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|