C19H28Cl2N2O2S — CID 17289507
3-morpholin-4-yl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]propan-1-amine;dihydrochloride (PubChem CID 17289507) has the molecular formula C19H28Cl2N2O2S and a molecular weight of 419.42 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 17289507 |
| Molecular Formula | C19H28Cl2N2O2S |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-morpholin-4-yl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.c1csc(COc2ccc(CNCCCN3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C19H26N2O2S.2ClH/c1-3-19(24-14-1)16-23-18-6-4-17(5-7-18)15-20-8-2-9-21-10-12-22-13-11-21;;/h1,3-7,14,20H,2,8-13,15-16H2;2*1H |
| InChIKey | DUBPJGFIVCYTEL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|