C18H26N2OS — CID 4723300
N',N'-diethyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethane-1,2-diamine (PubChem CID 4723300) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is N',N'-diethyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 4723300 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N',N'-diethyl-N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(OCc2cccs2)cc1 |
| InChI | InChI=1S/C18H26N2OS/c1-3-20(4-2)12-11-19-14-16-7-9-17(10-8-16)21-15-18-6-5-13-22-18/h5-10,13,19H,3-4,11-12,14-15H2,1-2H3 |
| InChIKey | SKTNVDCPJXNJTI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|