C20H27ClN2O — CID 4720085
N-[[4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 4720085) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 4720085 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H27ClN2O/c1-3-23(4-2)14-13-22-15-17-7-11-20(12-8-17)24-16-18-5-9-19(21)10-6-18/h5-12,22H,3-4,13-16H2,1-2H3 |
| InChIKey | SPXNNAPUQPPLKE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|