C18H22ClNO4 — CID 45100113
acetic acid;2-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol (PubChem CID 45100113) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is acetic acid;2-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol.
| Compound Name | acetic acid;2-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 45100113 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | acetic acid;2-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol |
| SMILES | CC(=O)O.OCCNCc1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H18ClNO2.C2H4O2/c17-15-5-1-14(2-6-15)12-20-16-7-3-13(4-8-16)11-18-9-10-19;1-2(3)4/h1-8,18-19H,9-12H2;1H3,(H,3,4) |
| InChIKey | XLOOIOQOUQYKDS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|