C23H23Cl2NO3 — CID 146309825
2-[[3,4-bis[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol (PubChem CID 146309825) has the molecular formula C23H23Cl2NO3 and a molecular weight of 432.35 g/mol. Its IUPAC name is 2-[[3,4-bis[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol.
| Compound Name | 2-[[3,4-bis[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 146309825 |
| Molecular Formula | C23H23Cl2NO3 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-[[3,4-bis[(4-chlorophenyl)methoxy]phenyl]methylamino]ethanol |
| SMILES | OCCNCc1ccc(OCc2ccc(Cl)cc2)c(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C23H23Cl2NO3/c24-20-6-1-17(2-7-20)15-28-22-10-5-19(14-26-11-12-27)13-23(22)29-16-18-3-8-21(25)9-4-18/h1-10,13,26-27H,11-12,14-16H2 |
| InChIKey | ZLOFYLYUEIUYBB-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|