C20H29Cl3N2O2 — CID 17294947
N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine;dihydrochloride (PubChem CID 17294947) has the molecular formula C20H29Cl3N2O2 and a molecular weight of 435.82 g/mol. Its IUPAC name is N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine;dihydrochloride.
| Compound Name | N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17294947 |
| Molecular Formula | C20H29Cl3N2O2 |
| Molecular Weight | 435.82 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | N-[[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-N',N'-dimethylethane-1,2-diamine;dihydrochloride |
| SMILES | CCOc1cc(CNCCN(C)C)ccc1OCc1ccc(Cl)cc1.Cl.Cl |
| InChI | InChI=1S/C20H27ClN2O2.2ClH/c1-4-24-20-13-17(14-22-11-12-23(2)3)7-10-19(20)25-15-16-5-8-18(21)9-6-16;;/h5-10,13,22H,4,11-12,14-15H2,1-3H3;2*1H |
| InChIKey | RTKRMXFABCDNCB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.82 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|