C17H21Cl2NO2 — CID 17290395
1-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]propan-2-ol;hydrochloride (PubChem CID 17290395) has the molecular formula C17H21Cl2NO2 and a molecular weight of 342.27 g/mol. Its IUPAC name is 1-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 17290395 |
| Molecular Formula | C17H21Cl2NO2 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 1-[[4-[(4-chlorophenyl)methoxy]phenyl]methylamino]propan-2-ol;hydrochloride |
| SMILES | CC(O)CNCc1ccc(OCc2ccc(Cl)cc2)cc1.Cl |
| InChI | InChI=1S/C17H20ClNO2.ClH/c1-13(20)10-19-11-14-4-8-17(9-5-14)21-12-15-2-6-16(18)7-3-15;/h2-9,13,19-20H,10-12H2,1H3;1H |
| InChIKey | LCNRAJADUITKBM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |