C13H20ClNO2 — CID 17290477
1-[(4-prop-2-enoxyphenyl)methylamino]propan-2-ol;hydrochloride (PubChem CID 17290477) has the molecular formula C13H20ClNO2 and a molecular weight of 257.76 g/mol. Its IUPAC name is 1-[(4-prop-2-enoxyphenyl)methylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-[(4-prop-2-enoxyphenyl)methylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 17290477 |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 1-[(4-prop-2-enoxyphenyl)methylamino]propan-2-ol;hydrochloride |
| SMILES | C=CCOc1ccc(CNCC(C)O)cc1.Cl |
| InChI | InChI=1S/C13H19NO2.ClH/c1-3-8-16-13-6-4-12(5-7-13)10-14-9-11(2)15;/h3-7,11,14-15H,1,8-10H2,2H3;1H |
| InChIKey | RMYXIMMADYUEIG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|