C19H25ClN2O — CID 23395727
2-[2-[[4-(4-chlorophenyl)phenyl]methylamino]ethyl-ethylamino]ethanol (PubChem CID 23395727) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 2-[2-[[4-(4-chlorophenyl)phenyl]methylamino]ethyl-ethylamino]ethanol.
| Compound Name | 2-[2-[[4-(4-chlorophenyl)phenyl]methylamino]ethyl-ethylamino]ethanol |
|---|---|
| PubChem CID | 23395727 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[2-[[4-(4-chlorophenyl)phenyl]methylamino]ethyl-ethylamino]ethanol |
| SMILES | CCN(CCO)CCNCc1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H25ClN2O/c1-2-22(13-14-23)12-11-21-15-16-3-5-17(6-4-16)18-7-9-19(20)10-8-18/h3-10,21,23H,2,11-15H2,1H3 |
| InChIKey | ZSRXSZCGVCMCIB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|