C19H25FN2 — CID 143241921
N',N'-diethyl-N-[[4-(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 143241921) has the molecular formula C19H25FN2 and a molecular weight of 300.42 g/mol. Its IUPAC name is N',N'-diethyl-N-[[4-(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[4-(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143241921 |
| Molecular Formula | C19H25FN2 |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N',N'-diethyl-N-[[4-(4-fluorophenyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H25FN2/c1-3-22(4-2)14-13-21-15-16-5-7-17(8-6-16)18-9-11-19(20)12-10-18/h5-12,21H,3-4,13-15H2,1-2H3 |
| InChIKey | OTKPSNUEWGKYHF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|