C24H35N3S — CID 142134549
N',N'-diethyl-N-[[4-(4-piperidin-1-ylsulfanylphenyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 142134549) has the molecular formula C24H35N3S and a molecular weight of 397.63 g/mol. Its IUPAC name is N',N'-diethyl-N-[[4-(4-piperidin-1-ylsulfanylphenyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[4-(4-piperidin-1-ylsulfanylphenyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 142134549 |
| Molecular Formula | C24H35N3S |
| Molecular Weight | 397.63 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | N',N'-diethyl-N-[[4-(4-piperidin-1-ylsulfanylphenyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(-c2ccc(SN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H35N3S/c1-3-26(4-2)19-16-25-20-21-8-10-22(11-9-21)23-12-14-24(15-13-23)28-27-17-6-5-7-18-27/h8-15,25H,3-7,16-20H2,1-2H3 |
| InChIKey | HFBQFHPXIIQFRI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.63 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|