C20H25F3N2 — CID 143241854
N',N'-diethyl-N-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 143241854) has the molecular formula C20H25F3N2 and a molecular weight of 350.43 g/mol. Its IUPAC name is N',N'-diethyl-N-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 143241854 |
| Molecular Formula | C20H25F3N2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N',N'-diethyl-N-[[4-[3-(trifluoromethyl)phenyl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(-c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H25F3N2/c1-3-25(4-2)13-12-24-15-16-8-10-17(11-9-16)18-6-5-7-19(14-18)20(21,22)23/h5-11,14,24H,3-4,12-13,15H2,1-2H3 |
| InChIKey | LZCBHLOQLJGYCW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|