C19H24F3N3 — CID 23395819
N',N'-diethyl-N-[[5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]ethane-1,2-diamine (PubChem CID 23395819) has the molecular formula C19H24F3N3 and a molecular weight of 351.42 g/mol. Its IUPAC name is N',N'-diethyl-N-[[5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 23395819 |
| Molecular Formula | C19H24F3N3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N',N'-diethyl-N-[[5-[4-(trifluoromethyl)phenyl]-2-pyridinyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(-c2ccc(C(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C19H24F3N3/c1-3-25(4-2)12-11-23-14-18-10-7-16(13-24-18)15-5-8-17(9-6-15)19(20,21)22/h5-10,13,23H,3-4,11-12,14H2,1-2H3 |
| InChIKey | XRVBHLLXMYOVBV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|