C17H21F3N4 — CID 162549188
N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine (PubChem CID 162549188) has the molecular formula C17H21F3N4 and a molecular weight of 338.38 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 162549188 |
| Molecular Formula | C17H21F3N4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| SMILES | CCN(C)CCNCc1cnc(-c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H21F3N4/c1-3-24(2)9-8-21-10-13-11-22-16(23-12-13)14-4-6-15(7-5-14)17(18,19)20/h4-7,11-12,21H,3,8-10H2,1-2H3 |
| InChIKey | PHIGHJJFRIVHCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|