About N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine
N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine (PubChem CID 162549188) has the molecular formula C17H21F3N4
and a molecular weight of 338.38 g/mol. Its IUPAC name is N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| PubChem CID | 162549188 |
| Molecular Formula | C17H21F3N4 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| SMILES | CCN(C)CCNCc1cnc(-c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H21F3N4/c1-3-24(2)9-8-21-10-13-11-22-16(23-12-13)14-4-6-15(7-5-14)17(18,19)20/h4-7,11-12,21H,3,8-10H2,1-2H3 |
| InChIKey | PHIGHJJFRIVHCZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The IUPAC name of N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine (CID 162549188) is N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine is CCN(C)CCNCc1cnc(-c2ccc(C(F)(F)F)cc2)nc1.
What is the InChIKey of N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The InChIKey is PHIGHJJFRIVHCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3N4/c1-3-24(2)9-8-21-10-13-11-22-16(23-12-13)14-4-6-15(7-5-14)17(18,19)20/h4-7,11-12,21H,3,8-10H2,1-2H3.
What are the key properties of N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine has a molecular weight of 338.38 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-methyl-N-[[2-[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]methyl]ethane-1,2-diamine is sourced from PubChem (CID 162549188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).