C15H23F3N2 — CID 62593658
N'-methyl-N-(2-methylpropyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 62593658) has the molecular formula C15H23F3N2 and a molecular weight of 288.36 g/mol. Its IUPAC name is N'-methyl-N-(2-methylpropyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N-(2-methylpropyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62593658 |
| Molecular Formula | C15H23F3N2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N'-methyl-N-(2-methylpropyl)-N'-[[4-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H23F3N2/c1-12(2)10-19-8-9-20(3)11-13-4-6-14(7-5-13)15(16,17)18/h4-7,12,19H,8-11H2,1-3H3 |
| InChIKey | JOEUPIYWRXUJKY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|