C19H27F3N2 — CID 162537190
N',N'-diethyl-N-[[3-[4-(trifluoromethyl)phenyl]-1-bicyclo[1.1.1]pentanyl]methyl]ethane-1,2-diamine (PubChem CID 162537190) has the molecular formula C19H27F3N2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N',N'-diethyl-N-[[3-[4-(trifluoromethyl)phenyl]-1-bicyclo[1.1.1]pentanyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[3-[4-(trifluoromethyl)phenyl]-1-bicyclo[1.1.1]pentanyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 162537190 |
| Molecular Formula | C19H27F3N2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | N',N'-diethyl-N-[[3-[4-(trifluoromethyl)phenyl]-1-bicyclo[1.1.1]pentanyl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCC12CC(c3ccc(C(F)(F)F)cc3)(C1)C2 |
| InChI | InChI=1S/C19H27F3N2/c1-3-24(4-2)10-9-23-14-17-11-18(12-17,13-17)15-5-7-16(8-6-15)19(20,21)22/h5-8,23H,3-4,9-14H2,1-2H3 |
| InChIKey | CQVKUQCGMYDJOP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|