C62H44F12 — CID 56647379
1,3,5,7-tetrakis[4-[4-(trifluoromethyl)phenyl]phenyl]adamantane (PubChem CID 56647379) has the molecular formula C62H44F12 and a molecular weight of 1017.01 g/mol. Its IUPAC name is 1,3,5,7-tetrakis[4-[4-(trifluoromethyl)phenyl]phenyl]adamantane.
| Compound Name | 1,3,5,7-tetrakis[4-[4-(trifluoromethyl)phenyl]phenyl]adamantane |
|---|---|
| PubChem CID | 56647379 |
| Molecular Formula | C62H44F12 |
| Molecular Weight | 1017.01 g/mol |
| Exact Mass | 1016.33 |
| IUPAC Name | 1,3,5,7-tetrakis[4-[4-(trifluoromethyl)phenyl]phenyl]adamantane |
| SMILES | FC(F)(F)c1ccc(-c2ccc(C34CC5(c6ccc(-c7ccc(C(F)(F)F)cc7)cc6)CC(c6ccc(-c7ccc(C(F)(F)F)cc7)cc6)(C3)CC(c3ccc(-c6ccc(C(F)(F)F)cc6)cc3)(C4)C5)cc2)cc1 |
| InChI | InChI=1S/C62H44F12/c63-59(64,65)51-25-9-43(10-26-51)39-1-17-47(18-2-39)55-33-56(48-19-3-40(4-20-48)44-11-27-52(28-12-44)60(66,67)68)36-57(34-55,49-21-5-41(6-22-49)45-13-29-53(30-14-45)61(69,70)71)38-58(35-55,37-56)50-23-7-42(8-24-50)46-15-31-54(32-16-46)62(72,73)74/h1-32H,33-38H2 |
| InChIKey | MAMNAGVGENVUCO-UHFFFAOYSA-N |
| XLogP | 18.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.01 |
| LogP ≤ 5 | 18.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |