C12H20FN3 — CID 104638488
N',N'-diethyl-N-[(5-fluoro-2-pyridinyl)methyl]ethane-1,2-diamine (PubChem CID 104638488) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is N',N'-diethyl-N-[(5-fluoro-2-pyridinyl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(5-fluoro-2-pyridinyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 104638488 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N',N'-diethyl-N-[(5-fluoro-2-pyridinyl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(F)cn1 |
| InChI | InChI=1S/C12H20FN3/c1-3-16(4-2)8-7-14-10-12-6-5-11(13)9-15-12/h5-6,9,14H,3-4,7-8,10H2,1-2H3 |
| InChIKey | JTNWKTKAOKGQRN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|