C13H24N4 — CID 83960493
N',N'-diethyl-N-(pyrazin-2-ylmethyl)butane-1,4-diamine (PubChem CID 83960493) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is N',N'-diethyl-N-(pyrazin-2-ylmethyl)butane-1,4-diamine.
| Compound Name | N',N'-diethyl-N-(pyrazin-2-ylmethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 83960493 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N',N'-diethyl-N-(pyrazin-2-ylmethyl)butane-1,4-diamine |
| SMILES | CCN(CC)CCCCNCc1cnccn1 |
| InChI | InChI=1S/C13H24N4/c1-3-17(4-2)10-6-5-7-14-11-13-12-15-8-9-16-13/h8-9,12,14H,3-7,10-11H2,1-2H3 |
| InChIKey | ALQYNOMRLAPGEO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|