C10H16N4O — CID 62762015
N,N-dimethyl-3-(pyrazin-2-ylmethylamino)propanamide (PubChem CID 62762015) has the molecular formula C10H16N4O and a molecular weight of 208.27 g/mol. Its IUPAC name is N,N-dimethyl-3-(pyrazin-2-ylmethylamino)propanamide.
| Compound Name | N,N-dimethyl-3-(pyrazin-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 62762015 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | N,N-dimethyl-3-(pyrazin-2-ylmethylamino)propanamide |
| SMILES | CN(C)C(=O)CCNCc1cnccn1 |
| InChI | InChI=1S/C10H16N4O/c1-14(2)10(15)3-4-11-7-9-8-12-5-6-13-9/h5-6,8,11H,3-4,7H2,1-2H3 |
| InChIKey | USLQPPFHTHUNML-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|