C10H18N4O — CID 60925704
N,N-dimethyl-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propanamide (PubChem CID 60925704) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N,N-dimethyl-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propanamide.
| Compound Name | N,N-dimethyl-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 60925704 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N,N-dimethyl-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propanamide |
| SMILES | Cc1[nH]ncc1CNCCC(=O)N(C)C |
| InChI | InChI=1S/C10H18N4O/c1-8-9(7-12-13-8)6-11-5-4-10(15)14(2)3/h7,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | KHFXVZVLIFALSL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|