C8H14N4O2 — CID 83210014
2-[(5-methyl-1H-pyrazol-4-yl)methylamino]ethyl carbamate (PubChem CID 83210014) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]ethyl carbamate.
| Compound Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210014 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]ethyl carbamate |
| SMILES | Cc1[nH]ncc1CNCCOC(N)=O |
| InChI | InChI=1S/C8H14N4O2/c1-6-7(5-11-12-6)4-10-2-3-14-8(9)13/h5,10H,2-4H2,1H3,(H2,9,13)(H,11,12) |
| InChIKey | CZKWCMGWKXYMSQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|