C9H16N4O — CID 43663761
N-ethyl-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetamide (PubChem CID 43663761) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-ethyl-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetamide.
| Compound Name | N-ethyl-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetamide |
|---|---|
| PubChem CID | 43663761 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-ethyl-2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetamide |
| SMILES | CCNC(=O)CNCc1cn[nH]c1C |
| InChI | InChI=1S/C9H16N4O/c1-3-11-9(14)6-10-4-8-5-12-13-7(8)2/h5,10H,3-4,6H2,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | QQAOWIPEYCZFIP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |