C7H11N3O2 — CID 43663721
2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetic acid (PubChem CID 43663721) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetic acid.
| Compound Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetic acid |
|---|---|
| PubChem CID | 43663721 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2-[(5-methyl-1H-pyrazol-4-yl)methylamino]acetic acid |
| SMILES | Cc1[nH]ncc1CNCC(=O)O |
| InChI | InChI=1S/C7H11N3O2/c1-5-6(3-9-10-5)2-8-4-7(11)12/h3,8H,2,4H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | PVPHYLVYGOFQRI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |