C9H13N3O3S — CID 104569662
2-[2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569662) has the molecular formula C9H13N3O3S and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-[2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569662 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-[2-[(5-methyl-1H-pyrazol-4-yl)methylamino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | Cc1[nH]ncc1CNC(=O)CSCC(=O)O |
| InChI | InChI=1S/C9H13N3O3S/c1-6-7(3-11-12-6)2-10-8(13)4-16-5-9(14)15/h3H,2,4-5H2,1H3,(H,10,13)(H,11,12)(H,14,15) |
| InChIKey | JQXMIMGCMZLGJG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |