C14H22N6O2 — CID 107256000
tert-butyl N-[4-[[(5-methyl-1H-pyrazol-4-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107256000) has the molecular formula C14H22N6O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is tert-butyl N-[4-[[(5-methyl-1H-pyrazol-4-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[(5-methyl-1H-pyrazol-4-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256000 |
| Molecular Formula | C14H22N6O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | tert-butyl N-[4-[[(5-methyl-1H-pyrazol-4-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | Cc1[nH]ncc1CNCc1cn[nH]c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N6O2/c1-9-10(7-16-19-9)5-15-6-11-8-17-20-12(11)18-13(21)22-14(2,3)4/h7-8,15H,5-6H2,1-4H3,(H,16,19)(H2,17,18,20,21) |
| InChIKey | QTAKOPIUCZGRJK-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |