C14H24N4O3 — CID 107256114
tert-butyl N-[4-[[(3-methyloxetan-3-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107256114) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3-methyloxetan-3-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3-methyloxetan-3-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256114 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | tert-butyl N-[4-[[(3-methyloxetan-3-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC1(CNCc2cn[nH]c2NC(=O)OC(C)(C)C)COC1 |
| InChI | InChI=1S/C14H24N4O3/c1-13(2,3)21-12(19)17-11-10(6-16-18-11)5-15-7-14(4)8-20-9-14/h6,15H,5,7-9H2,1-4H3,(H2,16,17,18,19) |
| InChIKey | FVMOQMLTDRRYQN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |