C15H26N4O3 — CID 107256057
tert-butyl N-[4-[(oxan-3-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107256057) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is tert-butyl N-[4-[(oxan-3-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(oxan-3-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256057 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | tert-butyl N-[4-[(oxan-3-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1[nH]ncc1CNCC1CCCOC1 |
| InChI | InChI=1S/C15H26N4O3/c1-15(2,3)22-14(20)18-13-12(9-17-19-13)8-16-7-11-5-4-6-21-10-11/h9,11,16H,4-8,10H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | JJKLNFCNKNPFLR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |