C16H19F3N4O2 — CID 114058013
tert-butyl N-[4-[[(2,4,5-trifluorophenyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 114058013) has the molecular formula C16H19F3N4O2 and a molecular weight of 356.35 g/mol. Its IUPAC name is tert-butyl N-[4-[[(2,4,5-trifluorophenyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[(2,4,5-trifluorophenyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 114058013 |
| Molecular Formula | C16H19F3N4O2 |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | tert-butyl N-[4-[[(2,4,5-trifluorophenyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1[nH]ncc1CNCc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C16H19F3N4O2/c1-16(2,3)25-15(24)22-14-10(8-21-23-14)7-20-6-9-4-12(18)13(19)5-11(9)17/h4-5,8,20H,6-7H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | QRDYIHRVVYLWGD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|