C14H19BrN4O2S — CID 107256103
tert-butyl N-[4-[[(3-bromothiophen-2-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107256103) has the molecular formula C14H19BrN4O2S and a molecular weight of 387.30 g/mol. Its IUPAC name is tert-butyl N-[4-[[(3-bromothiophen-2-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[(3-bromothiophen-2-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256103 |
| Molecular Formula | C14H19BrN4O2S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | tert-butyl N-[4-[[(3-bromothiophen-2-yl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1[nH]ncc1CNCc1sccc1Br |
| InChI | InChI=1S/C14H19BrN4O2S/c1-14(2,3)21-13(20)18-12-9(7-17-19-12)6-16-8-11-10(15)4-5-22-11/h4-5,7,16H,6,8H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | JIKNFUDZOHOHIU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |