C16H23N5O2 — CID 107256065
tert-butyl N-[4-[[(5-methyl-2-pyridinyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107256065) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[4-[[(5-methyl-2-pyridinyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[(5-methyl-2-pyridinyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107256065 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | tert-butyl N-[4-[[(5-methyl-2-pyridinyl)methylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | Cc1ccc(CNCc2cn[nH]c2NC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C16H23N5O2/c1-11-5-6-13(18-7-11)10-17-8-12-9-19-21-14(12)20-15(22)23-16(2,3)4/h5-7,9,17H,8,10H2,1-4H3,(H2,19,20,21,22) |
| InChIKey | IVZFDKYWDKZMPR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |