C15H21N5O2 — CID 107255989
tert-butyl N-[4-[(pyridin-4-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107255989) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is tert-butyl N-[4-[(pyridin-4-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(pyridin-4-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107255989 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | tert-butyl N-[4-[(pyridin-4-ylmethylamino)methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1[nH]ncc1CNCc1ccncc1 |
| InChI | InChI=1S/C15H21N5O2/c1-15(2,3)22-14(21)19-13-12(10-18-20-13)9-17-8-11-4-6-16-7-5-11/h4-7,10,17H,8-9H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | BXZLDXCVHDEEBS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |