C16H24N4O2S — CID 107255953
tert-butyl N-[4-[[1-(5-methylthiophen-2-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107255953) has the molecular formula C16H24N4O2S and a molecular weight of 336.46 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-(5-methylthiophen-2-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-(5-methylthiophen-2-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107255953 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | tert-butyl N-[4-[[1-(5-methylthiophen-2-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | Cc1ccc(C(C)NCc2cn[nH]c2NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C16H24N4O2S/c1-10-6-7-13(23-10)11(2)17-8-12-9-18-20-14(12)19-15(21)22-16(3,4)5/h6-7,9,11,17H,8H2,1-5H3,(H2,18,19,20,21) |
| InChIKey | HLCSPQVTSMWXFU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |