C15H22N4O3 — CID 107255974
tert-butyl N-[4-[[1-(furan-3-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate (PubChem CID 107255974) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is tert-butyl N-[4-[[1-(furan-3-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate.
| Compound Name | tert-butyl N-[4-[[1-(furan-3-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate |
|---|---|
| PubChem CID | 107255974 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | tert-butyl N-[4-[[1-(furan-3-yl)ethylamino]methyl]-1H-pyrazol-5-yl]carbamate |
| SMILES | CC(NCc1cn[nH]c1NC(=O)OC(C)(C)C)c1ccoc1 |
| InChI | InChI=1S/C15H22N4O3/c1-10(11-5-6-21-9-11)16-7-12-8-17-19-13(12)18-14(20)22-15(2,3)4/h5-6,8-10,16H,7H2,1-4H3,(H2,17,18,19,20) |
| InChIKey | MOWDGMZOQHCCRV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |