C16H22N4O2 — CID 103818455
tert-butyl N-[4-[(5-methyl-1H-pyrazol-4-yl)methylamino]phenyl]carbamate (PubChem CID 103818455) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is tert-butyl N-[4-[(5-methyl-1H-pyrazol-4-yl)methylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[(5-methyl-1H-pyrazol-4-yl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 103818455 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl N-[4-[(5-methyl-1H-pyrazol-4-yl)methylamino]phenyl]carbamate |
| SMILES | Cc1[nH]ncc1CNc1ccc(NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H22N4O2/c1-11-12(10-18-20-11)9-17-13-5-7-14(8-6-13)19-15(21)22-16(2,3)4/h5-8,10,17H,9H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | DRGBWIHYENICGL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |