C16H28N4O2 — CID 103720141
tert-butyl N-[3-[(5-methyl-1H-pyrazol-4-yl)methylamino]cyclohexyl]carbamate (PubChem CID 103720141) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-methyl-1H-pyrazol-4-yl)methylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[3-[(5-methyl-1H-pyrazol-4-yl)methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 103720141 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl N-[3-[(5-methyl-1H-pyrazol-4-yl)methylamino]cyclohexyl]carbamate |
| SMILES | Cc1[nH]ncc1CNC1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H28N4O2/c1-11-12(10-18-20-11)9-17-13-6-5-7-14(8-13)19-15(21)22-16(2,3)4/h10,13-14,17H,5-9H2,1-4H3,(H,18,20)(H,19,21) |
| InChIKey | KOPIOHHSXTVDMB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |