C13H20N2O5 — CID 83210035
2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl carbamate (PubChem CID 83210035) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl carbamate.
| Compound Name | 2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83210035 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 2-[(2,4,5-trimethoxyphenyl)methylamino]ethyl carbamate |
| SMILES | COc1cc(OC)c(OC)cc1CNCCOC(N)=O |
| InChI | InChI=1S/C13H20N2O5/c1-17-10-7-12(19-3)11(18-2)6-9(10)8-15-4-5-20-13(14)16/h6-7,15H,4-5,8H2,1-3H3,(H2,14,16) |
| InChIKey | SIKSDHORYSWHPP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|