C9H14N4O — CID 62763041
N-[2-(pyrazin-2-ylmethylamino)ethyl]acetamide (PubChem CID 62763041) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is N-[2-(pyrazin-2-ylmethylamino)ethyl]acetamide.
| Compound Name | N-[2-(pyrazin-2-ylmethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 62763041 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-[2-(pyrazin-2-ylmethylamino)ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cnccn1 |
| InChI | InChI=1S/C9H14N4O/c1-8(14)12-4-2-10-6-9-7-11-3-5-13-9/h3,5,7,10H,2,4,6H2,1H3,(H,12,14) |
| InChIKey | FEJBGBDZAGUIDO-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|