C22H33N3O3 — CID 161275558
anisole;2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylic acid (PubChem CID 161275558) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is anisole;2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylic acid.
| Compound Name | anisole;2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 161275558 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | anisole;2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylic acid |
| SMILES | CCN(CC)CCCCNCc1cc(C(=O)O)ccn1.COc1ccccc1 |
| InChI | InChI=1S/C15H25N3O2.C7H8O/c1-3-18(4-2)10-6-5-8-16-12-14-11-13(15(19)20)7-9-17-14;1-8-7-5-3-2-4-6-7/h7,9,11,16H,3-6,8,10,12H2,1-2H3,(H,19,20);2-6H,1H3 |
| InChIKey | VEJXQHGSEKKJGC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|