C25H38N4O — CID 78427614
2-benzyl-3-[[2-[[4-(diethylamino)butylamino]methyl]-4-pyridinyl]methylideneamino]propan-1-ol (PubChem CID 78427614) has the molecular formula C25H38N4O and a molecular weight of 410.61 g/mol. Its IUPAC name is 2-benzyl-3-[[2-[[4-(diethylamino)butylamino]methyl]-4-pyridinyl]methylideneamino]propan-1-ol.
| Compound Name | 2-benzyl-3-[[2-[[4-(diethylamino)butylamino]methyl]-4-pyridinyl]methylideneamino]propan-1-ol |
|---|---|
| PubChem CID | 78427614 |
| Molecular Formula | C25H38N4O |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | 2-benzyl-3-[[2-[[4-(diethylamino)butylamino]methyl]-4-pyridinyl]methylideneamino]propan-1-ol |
| SMILES | CCN(CC)CCCCNCc1cc(/C=N/CC(CO)Cc2ccccc2)ccn1 |
| InChI | InChI=1S/C25H38N4O/c1-3-29(4-2)15-9-8-13-26-20-25-17-23(12-14-28-25)18-27-19-24(21-30)16-22-10-6-5-7-11-22/h5-7,10-12,14,17-18,24,26,30H,3-4,8-9,13,15-16,19-21H2,1-2H3/b27-18+ |
| InChIKey | RWZKHITVXRPOKO-OVVQPSECSA-N |
| XLogP | 3.56 |
| TPSA | 60.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|